Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Aluminum oxide, 99.99%, (trace metal basis), extra pure
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 IUPAC Name: dialuminium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| IUPAC Name | dialuminium(3+) trioxidandiide |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Copper foil, 0.025mm (0.001in) thick, annealed, uncoated, 99.8% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Calcium chloride, 100mM aq. soln., sterile-filtered
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 MDL Number: MFCD00010903 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| MDL Number | MFCD00010903 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Lithium tetraborate, 99.6% (metals basis)
CAS: 12007-60-2 Molecular Formula: B4Li2O7 Molecular Weight (g/mol): 169.11 MDL Number: MFCD00011083 InChI Key: RDZCISUGRQUANA-UHFFFAOYSA-N IUPAC Name: dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) SMILES: [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2
| CAS | 12007-60-2 |
|---|---|
| Molecular Weight (g/mol) | 169.11 |
| MDL Number | MFCD00011083 |
| SMILES | [Li+].[Li+].[O-][B-]12O[B+]O[B-]([O-])(O[B+]O1)O2 |
| IUPAC Name | dilithium(1+) bicyclo[3.3.1]tetraboroxane-3,7-bis(ylium)-1,5-diuide-1,5-bis(olate) |
| InChI Key | RDZCISUGRQUANA-UHFFFAOYSA-N |
| Molecular Formula | B4Li2O7 |
Ammonium Sulfate, 99.0% (ACS Guaranteed Reagent), MilliporeSigma™
CAS: 7783-20-2 Molecular Formula: H8N2O4S Molecular Weight (g/mol): 132.13 MDL Number: MFCD00003391 InChI Key: BFNBIHQBYMNNAN-UHFFFAOYSA-N Synonym: ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate PubChem CID: 6097028 ChEBI: CHEBI:62946 IUPAC Name: sulfuric acid diamine SMILES: N.N.OS(O)(=O)=O
| PubChem CID | 6097028 |
|---|---|
| CAS | 7783-20-2 |
| Molecular Weight (g/mol) | 132.13 |
| ChEBI | CHEBI:62946 |
| MDL Number | MFCD00003391 |
| SMILES | N.N.OS(O)(=O)=O |
| Synonym | ammonium sulfate,diammonium sulfate,ammonium sulphate,mascagnite,sulfuric acid diammonium salt,ammonium sulfate 2:1,ammoniumsulfate,actamaster,sulfuric acid, diammonium salt,diammonium sulphate |
| IUPAC Name | sulfuric acid diamine |
| InChI Key | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| Molecular Formula | H8N2O4S |
Selenium(IV) oxide, 99.8%, (trace metal basis)
CAS: 7446-08-4 Molecular Formula: O2Se Molecular Weight (g/mol): 110.97 MDL Number: MFCD00003562 InChI Key: JPJALAQPGMAKDF-UHFFFAOYSA-N Synonym: selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 PubChem CID: 24007 SMILES: O=[Se]=O
| PubChem CID | 24007 |
|---|---|
| CAS | 7446-08-4 |
| Molecular Weight (g/mol) | 110.97 |
| MDL Number | MFCD00003562 |
| SMILES | O=[Se]=O |
| Synonym | selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 |
| InChI Key | JPJALAQPGMAKDF-UHFFFAOYSA-N |
| Molecular Formula | O2Se |
Potassium hexacyanoferrate(II) trihydrate, 98+%
CAS: 14459-95-1 Molecular Formula: C6H6FeK4N6O3 Molecular Weight (g/mol): 422.39 MDL Number: MFCD00167023 InChI Key: NLYKFUFIUWPPIZ-UHFFFAOYSA-N Synonym: Potassium ferrocyanide trihydrate IUPAC Name: tetrapotassium hexacyanoironbis(ylium) trihydrate SMILES: O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N
| CAS | 14459-95-1 |
|---|---|
| Molecular Weight (g/mol) | 422.39 |
| MDL Number | MFCD00167023 |
| SMILES | O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | Potassium ferrocyanide trihydrate |
| IUPAC Name | tetrapotassium hexacyanoironbis(ylium) trihydrate |
| InChI Key | NLYKFUFIUWPPIZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6FeK4N6O3 |
Nitrosonium tetrafluoroborate, 98%
CAS: 14635-75-7 Molecular Formula: BF4HNO2 Molecular Weight (g/mol): 133.82 MDL Number: MFCD00011433 InChI Key: XYRQURYIJKJVSF-UHFFFAOYSA-N Synonym: nitrosonium tetrafluoroborate,nitrosyl tetrafluoroborate,nitrosyltetrafluoroborate,nobf4,nitrilooxonium tetrafluoroborate,azanylidyneoxidanium tetrafluoroborate PubChem CID: 11137142 IUPAC Name: azanylidyneoxidanium;tetrafluoroborate SMILES: [O-][NH+]=O.F[B-](F)(F)F
| PubChem CID | 11137142 |
|---|---|
| CAS | 14635-75-7 |
| Molecular Weight (g/mol) | 133.82 |
| MDL Number | MFCD00011433 |
| SMILES | [O-][NH+]=O.F[B-](F)(F)F |
| Synonym | nitrosonium tetrafluoroborate,nitrosyl tetrafluoroborate,nitrosyltetrafluoroborate,nobf4,nitrilooxonium tetrafluoroborate,azanylidyneoxidanium tetrafluoroborate |
| IUPAC Name | azanylidyneoxidanium;tetrafluoroborate |
| InChI Key | XYRQURYIJKJVSF-UHFFFAOYSA-N |
| Molecular Formula | BF4HNO2 |
Cadmium nitrate tetrahydrate, Puratronic™, 99.999% (metals basis)
CAS: 10022-68-1 Molecular Formula: CdH2N2O6 Molecular Weight (g/mol): 238.44 MDL Number: MFCD00149626 InChI Key: IZIPRBSCGMISKX-UHFFFAOYSA-N Synonym: cadmium nitrate tetrahydrate,nitric acid, cadmium salt, tetrahydrate,cd no3 2.4h2o,acmc-20aljb,ksc174c1h,cadmium nitrate-water 1/4,cadmiumnitratetetrahydrate,cadmium ii nitrate tetrahydrate,nitric acid, cadmium salt tetrahydrate PubChem CID: 56924536 ChEBI: CHEBI:86156 SMILES: [Cd++].O[N+]([O-])=O.O[N+]([O-])=O
| PubChem CID | 56924536 |
|---|---|
| CAS | 10022-68-1 |
| Molecular Weight (g/mol) | 238.44 |
| ChEBI | CHEBI:86156 |
| MDL Number | MFCD00149626 |
| SMILES | [Cd++].O[N+]([O-])=O.O[N+]([O-])=O |
| Synonym | cadmium nitrate tetrahydrate,nitric acid, cadmium salt, tetrahydrate,cd no3 2.4h2o,acmc-20aljb,ksc174c1h,cadmium nitrate-water 1/4,cadmiumnitratetetrahydrate,cadmium ii nitrate tetrahydrate,nitric acid, cadmium salt tetrahydrate |
| InChI Key | IZIPRBSCGMISKX-UHFFFAOYSA-N |
| Molecular Formula | CdH2N2O6 |
Iodine trichloride, 97%
CAS: 865-44-1 Molecular Formula: Cl3I Molecular Weight (g/mol): 233.254 MDL Number: MFCD00036291 InChI Key: PAWIVBWALDNUJP-UHFFFAOYSA-N Synonym: iodine trichloride,iodine chloride icl3,unii-1e5kq66trq,1e5kq66trq,jodtrichlorid,trichloro-,e3-iodane,trichloro-$l^ 3-iodane,ksc450m5f,iodine trichloride, saj first grade PubChem CID: 70076 IUPAC Name: trichloro-$l^{3}-iodane SMILES: ClI(Cl)Cl
| PubChem CID | 70076 |
|---|---|
| CAS | 865-44-1 |
| Molecular Weight (g/mol) | 233.254 |
| MDL Number | MFCD00036291 |
| SMILES | ClI(Cl)Cl |
| Synonym | iodine trichloride,iodine chloride icl3,unii-1e5kq66trq,1e5kq66trq,jodtrichlorid,trichloro-,e3-iodane,trichloro-$l^ 3-iodane,ksc450m5f,iodine trichloride, saj first grade |
| IUPAC Name | trichloro-$l^{3}-iodane |
| InChI Key | PAWIVBWALDNUJP-UHFFFAOYSA-N |
| Molecular Formula | Cl3I |
Potassium phosphate, tribasic monohydrate, 96%, extra pure
CAS: 27176-10-9 Molecular Formula: K3O4P·H2O Molecular Weight (g/mol): 230.28 MDL Number: MFCD00150410 InChI Key: RMNIZOOYFMNEJJ-UHFFFAOYSA-K Synonym: tri-potassium phosphate monohydrate,potassium phosphate tribasic monohydrate,potassium phosphate hydrate,potassium phosphate monohydrate,unii-4927m96tfv,tert-potassium phosphate monohydrate,potassium phosphate, tribasic, monohydrate,phosphoric acid, tripotassium salt, monohydrate,tripotassium phosphate, monohydrate,acmc-1chx7 PubChem CID: 22031701 IUPAC Name: tripotassium;phosphate;hydrate SMILES: O.[O-]P(=O)([O-])[O-].[K+].[K+].[K+]
| PubChem CID | 22031701 |
|---|---|
| CAS | 27176-10-9 |
| Molecular Weight (g/mol) | 230.28 |
| MDL Number | MFCD00150410 |
| SMILES | O.[O-]P(=O)([O-])[O-].[K+].[K+].[K+] |
| Synonym | tri-potassium phosphate monohydrate,potassium phosphate tribasic monohydrate,potassium phosphate hydrate,potassium phosphate monohydrate,unii-4927m96tfv,tert-potassium phosphate monohydrate,potassium phosphate, tribasic, monohydrate,phosphoric acid, tripotassium salt, monohydrate,tripotassium phosphate, monohydrate,acmc-1chx7 |
| IUPAC Name | tripotassium;phosphate;hydrate |
| InChI Key | RMNIZOOYFMNEJJ-UHFFFAOYSA-K |
| Molecular Formula | K3O4P·H2O |
Barium chloride, anhydrous, 99.998% (metals basis)
CAS: 10361-37-2 Molecular Formula: BaCl2 Molecular Weight (g/mol): 208.23 MDL Number: MFCD00003445 InChI Key: WDIHJSXYQDMJHN-UHFFFAOYSA-L Synonym: barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 PubChem CID: 25204 ChEBI: CHEBI:63317 SMILES: [Cl-].[Cl-].[Ba++]
| PubChem CID | 25204 |
|---|---|
| CAS | 10361-37-2 |
| Molecular Weight (g/mol) | 208.23 |
| ChEBI | CHEBI:63317 |
| MDL Number | MFCD00003445 |
| SMILES | [Cl-].[Cl-].[Ba++] |
| Synonym | barium chloride,barium dichloride,barium chloride solution,ccris 2286,barium chloride, anhydrous,barium chloride, ultra dry,bariumchlorid,dichlorobarium,dsstox_cid_24508 |
| InChI Key | WDIHJSXYQDMJHN-UHFFFAOYSA-L |
| Molecular Formula | BaCl2 |
Lithium borohydride, 95%
CAS: 16949-15-8 Molecular Formula: BH4Li Molecular Weight (g/mol): 21.78 MDL Number: MFCD00011088 InChI Key: UUKMSDRCXNLYOO-UHFFFAOYSA-N Synonym: borate 1-, tetrahydro-, lithium,unii-8l87x4s4kp,boryllithium,lithium, boryl,lithium hydroborate,lithotab borohydride,bh4li,lithium 1+ ion boranuide,lithium borohydride 2.0 m in thf,borate 1-, tetrahydro-, lithium 1:1 PubChem CID: 20722760 SMILES: [Li+].[BH4-]
| PubChem CID | 20722760 |
|---|---|
| CAS | 16949-15-8 |
| Molecular Weight (g/mol) | 21.78 |
| MDL Number | MFCD00011088 |
| SMILES | [Li+].[BH4-] |
| Synonym | borate 1-, tetrahydro-, lithium,unii-8l87x4s4kp,boryllithium,lithium, boryl,lithium hydroborate,lithotab borohydride,bh4li,lithium 1+ ion boranuide,lithium borohydride 2.0 m in thf,borate 1-, tetrahydro-, lithium 1:1 |
| InChI Key | UUKMSDRCXNLYOO-UHFFFAOYSA-N |
| Molecular Formula | BH4Li |
| Form | Ingot |
|---|---|
| Solubility Information | Insoluble in water. |
| Chemical Name or Material | Bismuth Indium Tin ingot (Field's metal) |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Avg. Mol. Wt. or Mol. Wt. Range | Bi:In:Sn; 32.5:51:16.5 wt% |
Potassium hydrogen phosphate, dried, 98+%
CAS: 11-4-7758 Molecular Formula: HK2O4P Molecular Weight (g/mol): 174.17 MDL Number: MFCD00011383 InChI Key: ZPWVASYFFYYZEW-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate PubChem CID: 24450 ChEBI: CHEBI:32031 IUPAC Name: dipotassium;hydrogen phosphate SMILES: OP(=O)([O-])[O-].[K+].[K+]
| PubChem CID | 24450 |
|---|---|
| CAS | 11-4-7758 |
| Molecular Weight (g/mol) | 174.17 |
| ChEBI | CHEBI:32031 |
| MDL Number | MFCD00011383 |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Molecular Formula | HK2O4P |